* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KINGSHCHEM 51230 |
English Synonyms: | KINGSHCHEM 51230 |
MDL Number.: | MFCD17213571 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(C)c1ccc(cc1)c2cc3cccc(c3[nH]2)Br |
InChi: | InChI=1S/C18H18BrN/c1-3-12(2)13-7-9-14(10-8-13)17-11-15-5-4-6-16(19)18(15)20-17/h4-12,20H,3H2,1-2H3 |
InChiKey: | InChIKey=AUONYUZLHUCVBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.