* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-2-(3,6-DICHLORO-2-METHOXYPHENYL)-1H-INDOLE |
| English Synonyms: | 7-BROMO-2-(3,6-DICHLORO-2-METHOXYPHENYL)-1H-INDOLE |
| MDL Number.: | MFCD17213604 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | COc1c(ccc(c1c2cc3cccc(c3[nH]2)Br)Cl)Cl |
| InChi: | InChI=1S/C15H10BrCl2NO/c1-20-15-11(18)6-5-10(17)13(15)12-7-8-3-2-4-9(16)14(8)19-12/h2-7,19H,1H3 |
| InChiKey: | InChIKey=JVCDKTLSUTVUDS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.