* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX-CF022450 |
English Synonyms: | ZERENEX ZX-CF022450 |
MDL Number.: | MFCD17214331 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C[C@@]12CC[C@@](C1)([C@@]3([C@]2(CCC3)C)C)C |
InChi: | InChI=1S/C14H24/c1-11-8-9-12(2,10-11)14(4)7-5-6-13(11,14)3/h5-10H2,1-4H3/t11-,12+,13+,14- |
InChiKey: | InChIKey=HFDBLHGEKMWGRC-LVEBTZEWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.