* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF022475 |
| English Synonyms: | ZERENEX ZX-CF022475 |
| MDL Number.: | MFCD17214333 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(=O)NS(=O)(=O)c1ccc(cc1)CCN |
| InChi: | InChI=1S/C10H14N2O3S/c1-8(13)12-16(14,15)10-4-2-9(3-5-10)6-7-11/h2-5H,6-7,11H2,1H3,(H,12,13) |
| InChiKey: | InChIKey=YFYWAMYADSXMSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.