* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BICYCLO[2.2.1]HEPTANE-2-CARBOXYLIC ACID, 2-AMINO-, (1R,2S,4S)-REL- |
CAS: | 39669-35-7 |
English Synonyms: | BICYCLO[2.2.1]HEPTANE-2-CARBOXYLIC ACID, 2-AMINO-, (1R,2S,4S)-REL- |
MDL Number.: | MFCD17214514 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1C[C@@H]2C[C@H]1C[C@]2(C(=O)O)N |
InChi: | InChI=1S/C8H13NO2/c9-8(7(10)11)4-5-1-2-6(8)3-5/h5-6H,1-4,9H2,(H,10,11)/t5-,6+,8-/m0/s1 |
InChiKey: | InChIKey=MPUVBVXDFRDIPT-BBVRLYRLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.