* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOQUINOLINE, 1,2,3,4-TETRAHYDRO-3-(1-PIPERIDINYLMETHYL)-, (3S)- |
| CAS: | 256373-11-2 |
| English Synonyms: | ISOQUINOLINE, 1,2,3,4-TETRAHYDRO-3-(1-PIPERIDINYLMETHYL)-, (3S)- |
| MDL Number.: | MFCD17214584 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C[C@H](NC2)CN3CCCCC3 |
| InChi: | InChI=1S/C15H22N2/c1-4-8-17(9-5-1)12-15-10-13-6-2-3-7-14(13)11-16-15/h2-3,6-7,15-16H,1,4-5,8-12H2/t15-/m0/s1 |
| InChiKey: | InChIKey=MOXWARQHLIFLKP-HNNXBMFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.