* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HARMALIDINE |
| CAS: | 109794-97-0 |
| English Synonyms: | HARMALIDINE |
| MDL Number.: | MFCD17214782 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC1(Cn2c3cc(ccc3c4c2C1=NCC4)OC)C |
| InChi: | InChI=1S/C16H18N2O/c1-16(2)9-18-13-8-10(19-3)4-5-11(13)12-6-7-17-15(16)14(12)18/h4-5,8H,6-7,9H2,1-3H3 |
| InChiKey: | InChIKey=CTEKBWZEYYSNFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.