* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WILSONINE |
| CAS: | 39024-12-9 |
| English Synonyms: | WILSONINE |
| MDL Number.: | MFCD17214789 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | COc1cc2c(cc1OC)[C@]34C[C@@H](C=C[C@@]35[C@H](O5)CN4CCC2)OC |
| InChi: | InChI=1S/C20H25NO4/c1-22-14-6-7-20-18(25-20)12-21-8-4-5-13-9-16(23-2)17(24-3)10-15(13)19(20,21)11-14/h6-7,9-10,14,18H,4-5,8,11-12H2,1-3H3/t14-,18-,19-,20-/m1/s1 |
| InChiKey: | InChIKey=JCKPCZAYDZJZIL-LMFCIFFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.