* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINOVIN |
CAS: | 107870-05-3 |
English Synonyms: | QUINOVIN |
MDL Number.: | MFCD17214828 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C)O)O)O)C)C)[C@@H]2[C@H]1C)C(=O)O)C(=O)O |
InChi: | InChI=1S/C36H56O9/c1-18-10-15-35(30(40)41)16-17-36(31(42)43)21(25(35)19(18)2)8-9-23-33(6)13-12-24(32(4,5)22(33)11-14-34(23,36)7)45-29-28(39)27(38)26(37)20(3)44-29/h8,18-20,22-29,37-39H,9-17H2,1-7H3,(H,40,41)(H,42,43)/t18-,19+,20-,22+,23-,24+,25+,26-,27+,28-,29+,33+,34-,35+,36-/m1/s1 |
InChiKey: | InChIKey=PUOQHFWXBKTHST-DLCGLXBKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.