* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DELTA-AMYRIN ACETATE |
| CAS: | 51361-60-5 |
| English Synonyms: | DELTA-AMYRIN ACETATE |
| MDL Number.: | MFCD17214829 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(=O)O[C@H]1CC[C@@]2([C@H]3CCC4=C5CC(CC[C@@]5(CC[C@]4([C@@]3(CC[C@H]2C1(C)C)C)C)C)(C)C)C |
| InChi: | InChI=1S/C32H52O2/c1-21(33)34-26-13-14-30(7)24(28(26,4)5)12-15-32(9)25(30)11-10-22-23-20-27(2,3)16-17-29(23,6)18-19-31(22,32)8/h24-26H,10-20H2,1-9H3/t24-,25+,26-,29+,30-,31+,32+/m0/s1 |
| InChiKey: | InChIKey=HPCVECTWKNBXCO-LNFVHJCCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.