* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOART-25-ENE-3,24-DIOL |
| CAS: | 10388-48-4 |
| English Synonyms: | CYCLOART-25-ENE-3,24-DIOL |
| MDL Number.: | MFCD17214830 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | C[C@H](CCC(C(=C)C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C |
| InChi: | InChI=1S/C30H50O2/c1-19(2)22(31)9-8-20(3)21-12-14-28(7)24-11-10-23-26(4,5)25(32)13-15-29(23)18-30(24,29)17-16-27(21,28)6/h20-25,31-32H,1,8-18H2,2-7H3/t20-,21-,22?,23+,24+,25+,27-,28+,29-,30+/m1/s1 |
| InChiKey: | InChIKey=MHGLNDDJLDJDBG-GSYFYXRESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.