* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OCOTILLONE |
| CAS: | 22549-21-9 |
| English Synonyms: | (20R,24S)-20,24-EPOXY-25-HYDROXYDAMMARAN-3-ONE ; OCOTILLONE |
| MDL Number.: | MFCD17214841 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1([C@@H]2CC[C@@]3([C@@H]([C@]2(CCC1=O)C)CC[C@H]4[C@]3(CC[C@@H]4[C@]5(CC[C@H](O5)C(C)(C)O)C)C)C)C |
| InChi: | InChI=1S/C30H50O3/c1-25(2)21-12-17-29(7)22(27(21,5)15-13-23(25)31)10-9-19-20(11-16-28(19,29)6)30(8)18-14-24(33-30)26(3,4)32/h19-22,24,32H,9-18H2,1-8H3/t19-,20+,21+,22-,24+,27+,28-,29-,30-/m1/s1 |
| InChiKey: | InChIKey=XSQYWMLMQVUWSF-FEDWKDCGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.