* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHATIN |
| CAS: | 26791-73-1 |
| English Synonyms: | XANTHATIN |
| MDL Number.: | MFCD17214852 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | C[C@H]1C[C@H]2[C@H](CC=C1/C=C/C(=O)C)C(=C)C(=O)O2 |
| InChi: | InChI=1S/C15H18O3/c1-9-8-14-13(11(3)15(17)18-14)7-6-12(9)5-4-10(2)16/h4-6,9,13-14H,3,7-8H2,1-2H3/b5-4+/t9-,13+,14-/m0/s1 |
| InChiKey: | InChIKey=RBRPTFMVULVGIC-ZTIIIDENSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.