* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-OXONEROLIDOL |
| CAS: | 58865-88-6 |
| English Synonyms: | 9-OXONEROLIDOL |
| MDL Number.: | MFCD17214856 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC[C@](C)(CC/C=C(\C)/CC(=O)C=C(C)C)O |
| InChi: | InChI=1S/C15H26O2/c1-6-15(5,17)9-7-8-13(4)11-14(16)10-12(2)3/h8,10,17H,6-7,9,11H2,1-5H3/b13-8+/t15-/m1/s1 |
| InChiKey: | InChIKey=UAPRDFGMMVQQSJ-XETPBLJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.