* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROSEOSIDE |
CAS: | 54835-70-0 |
English Synonyms: | ROSEOSIDE |
MDL Number.: | MFCD17214862 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | CC1=CC(=O)CC([C@]1(/C=C/[C@@H](C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)(C)C |
InChi: | InChI=1S/C19H30O8/c1-10-7-12(21)8-18(3,4)19(10,25)6-5-11(2)26-17-16(24)15(23)14(22)13(9-20)27-17/h5-7,11,13-17,20,22-25H,8-9H2,1-4H3/b6-5+/t11-,13-,14-,15+,16-,17-,19-/m1/s1 |
InChiKey: | InChIKey=SWYRVCGNMNAFEK-MHXFFUGFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.