* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CORONARIN D |
| CAS: | 119188-37-3 |
| English Synonyms: | CORONARIN D |
| MDL Number.: | MFCD17214867 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1(CCC[C@]2([C@H]1CCC(=C)[C@@H]2C/C=C/3\CC(OC3=O)O)C)C |
| InChi: | InChI=1S/C20H30O3/c1-13-6-9-16-19(2,3)10-5-11-20(16,4)15(13)8-7-14-12-17(21)23-18(14)22/h7,15-17,21H,1,5-6,8-12H2,2-4H3/b14-7+/t15-,16-,17?,20+/m0/s1 |
| InChiKey: | InChIKey=DYYYQLXAGIXUGM-JQFPLDQISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.