* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROSTHORNIN A |
CAS: | 125164-55-8 |
English Synonyms: | ROSTHORNIN A |
MDL Number.: | MFCD17214869 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(=O)O[C@H]1C[C@@]2(C[C@]3([C@@H]1[C@@]4(CCC[C@@]([C@H]4CC3)(C)CO)C)C(=O)C2=C)O |
InChi: | InChI=1S/C22H32O5/c1-13-18(25)21-9-6-16-19(3,12-23)7-5-8-20(16,4)17(21)15(27-14(2)24)10-22(13,26)11-21/h15-17,23,26H,1,5-12H2,2-4H3/t15-,16+,17-,19-,20+,21+,22-/m0/s1 |
InChiKey: | InChIKey=PYPRWTSCIQSVKE-WCYDGLNHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.