* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-HYDROXY-13E-LABDEN-15-OIC ACID |
| CAS: | 132915-47-0 |
| English Synonyms: | 9-HYDROXY-13E-LABDEN-15-OIC ACID |
| MDL Number.: | MFCD17214873 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C[C@@H]1CC[C@H]2C(CCC[C@@]2([C@]1(CC/C(=C/C(=O)O)/C)O)C)(C)C |
| InChi: | InChI=1S/C20H34O3/c1-14(13-17(21)22)9-12-20(23)15(2)7-8-16-18(3,4)10-6-11-19(16,20)5/h13,15-16,23H,6-12H2,1-5H3,(H,21,22)/b14-13+/t15-,16+,19+,20-/m1/s1 |
| InChiKey: | InChIKey=GVGJRMWFFTWASU-LKZYJNOJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.