* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LIANGSHANIN A |
CAS: | 122717-54-8 |
English Synonyms: | LIANGSHANIN A |
MDL Number.: | MFCD17214884 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC1([C@H]2C[C@H]([C@]34[C@H]([C@@]2(C=CC1=O)C)CC[C@H]([C@H]3O)C(=C)C4=O)O)C |
InChi: | InChI=1S/C20H26O4/c1-10-11-5-6-12-19(4)8-7-14(21)18(2,3)13(19)9-15(22)20(12,16(10)23)17(11)24/h7-8,11-13,15,17,22,24H,1,5-6,9H2,2-4H3/t11-,12-,13+,15+,17+,19-,20-/m0/s1 |
InChiKey: | InChIKey=CNTXARLHZHVLRV-MJTHGBBVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.