* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 13-HYDROXY-8,11,13-PODOCARPATRIEN-18-OIC ACID |
| CAS: | 61597-83-9 |
| English Synonyms: | 13-HYDROXY-8,11,13-PODOCARPATRIEN-18-OIC ACID |
| MDL Number.: | MFCD17214889 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C[C@]12CCC[C@@]([C@@H]1CCc3c2ccc(c3)O)(C)C(=O)O |
| InChi: | InChI=1S/C17H22O3/c1-16-8-3-9-17(2,15(19)20)14(16)7-4-11-10-12(18)5-6-13(11)16/h5-6,10,14,18H,3-4,7-9H2,1-2H3,(H,19,20)/t14-,16-,17-/m1/s1 |
| InChiKey: | InChIKey=DWHTYLMRWXUGJL-DJIMGWMZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.