* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHELLOCHIN |
| CAS: | 115334-04-8 |
| English Synonyms: | PHELLOCHIN |
| MDL Number.: | MFCD17214893 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@@H](C[C@H]([C@@H](C(C)(C)OC)O)O)[C@H]1CC[C@]2([C@]1(CC[C@H]3C2=CC[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
| InChi: | InChI=1S/C31H52O4/c1-19(18-23(32)26(34)28(4,5)35-9)20-12-16-31(8)22-10-11-24-27(2,3)25(33)14-15-29(24,6)21(22)13-17-30(20,31)7/h10,19-21,23-24,26,32,34H,11-18H2,1-9H3/t19-,20+,21-,23+,24-,26-,29+,30-,31+/m0/s1 |
| InChiKey: | InChIKey=OCURJKDUYAFAQG-DEZJOOMBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.