* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GALANOLACTONE |
| CAS: | 115753-79-2 |
| English Synonyms: | GALANOLACTONE |
| MDL Number.: | MFCD17214898 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC1(CCC[C@]2([C@H]1CC[C@]3([C@@H]2C/C=C/4\CCOC4=O)CO3)C)C |
| InChi: | InChI=1S/C20H30O3/c1-18(2)9-4-10-19(3)15(18)7-11-20(13-23-20)16(19)6-5-14-8-12-22-17(14)21/h5,15-16H,4,6-13H2,1-3H3/b14-5+/t15-,16+,19-,20+/m0/s1 |
| InChiKey: | InChIKey=MBPTXJNHCBXMBP-SDIIOJARSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.