* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIOSBULBIN I |
| CAS: | 1187951-05-8 |
| English Synonyms: | DIOSBULBIN I |
| MDL Number.: | MFCD17214901 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | C[C@@]12C[C@H](OC(=O)[C@H]1C[C@@H]([C@H]3[C@H]2C[C@@H]4C[C@H]3C(=O)O4)OC(=O)/C=C/c5ccc(cc5)OC)c6ccoc6 |
| InChi: | InChI=1S/C29H30O8/c1-29-14-24(17-9-10-34-15-17)37-28(32)22(29)13-23(26-20-11-19(12-21(26)29)35-27(20)31)36-25(30)8-5-16-3-6-18(33-2)7-4-16/h3-10,15,19-24,26H,11-14H2,1-2H3/b8-5+/t19-,20+,21+,22+,23-,24-,26+,29-/m0/s1 |
| InChiKey: | InChIKey=NFXKFVAWBBOWIJ-WBQZIMCXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.