* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DAMMARENEDIOL II |
| CAS: | 14351-29-2 |
| English Synonyms: | DAMMARENEDIOL II |
| MDL Number.: | MFCD17214902 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CC(=CCC[C@@](C)([C@H]1CC[C@@]2([C@@H]1CC[C@H]3[C@]2(CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C)O)C |
| InChi: | InChI=1S/C30H52O2/c1-20(2)10-9-16-30(8,32)22-13-18-28(6)21(22)11-12-24-27(5)17-15-25(31)26(3,4)23(27)14-19-29(24,28)7/h10,21-25,31-32H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25+,27+,28-,29-,30+/m1/s1 |
| InChiKey: | InChIKey=NLHQJXWYMZLQJY-TXNIMPHESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.