* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OPLOPANONE |
| CAS: | 1911-78-0 |
| English Synonyms: | OPLOPANONE |
| MDL Number.: | MFCD17214906 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)[C@@H]1CC[C@@]([C@H]2[C@H]1[C@H](CC2)C(=O)C)(C)O |
| InChi: | InChI=1S/C15H26O2/c1-9(2)11-7-8-15(4,17)13-6-5-12(10(3)16)14(11)13/h9,11-14,17H,5-8H2,1-4H3/t11-,12+,13+,14+,15+/m0/s1 |
| InChiKey: | InChIKey=WLXJHVQYKOJBBN-NJVJYBDUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.