* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZIYUGLYCOSIDE II |
| CAS: | 35286-59-0 |
| English Synonyms: | ZIYUGLYCOSIDE II |
| MDL Number.: | MFCD17214911 |
| H bond acceptor: | 8 |
| H bond donor: | 5 |
| Smile: | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)O)O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O |
| InChi: | InChI=1S/C35H56O8/c1-19-10-15-35(29(39)40)17-16-32(5)20(27(35)34(19,7)41)8-9-23-31(4)13-12-24(30(2,3)22(31)11-14-33(23,32)6)43-28-26(38)25(37)21(36)18-42-28/h8,19,21-28,36-38,41H,9-18H2,1-7H3,(H,39,40)/t19-,21+,22+,23-,24+,25+,26-,27-,28+,31+,32-,33-,34-,35+/m1/s1 |
| InChiKey: | InChIKey=MFIXLWYJTVEVGO-YHGWSDCJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.