* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUBIFOLIC ACID |
CAS: | 80489-65-2 |
English Synonyms: | RUBIFOLIC ACID |
MDL Number.: | MFCD17214916 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C[C@H]1[C@@H](CC[C@]2([C@@H]1C3=CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C(=O)O)CO |
InChi: | InChI=1S/C30H48O4/c1-18-19(17-31)9-14-30(25(33)34)16-15-28(5)20(24(18)30)7-8-22-27(4)12-11-23(32)26(2,3)21(27)10-13-29(22,28)6/h7,18-19,21-24,31-32H,8-17H2,1-6H3,(H,33,34)/t18-,19-,21-,22+,23-,24-,27-,28+,29+,30-/m0/s1 |
InChiKey: | InChIKey=UBLKZBSRTSLNTC-RRHGHHQTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.