* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GANODEROL A |
| CAS: | 104700-97-2 |
| English Synonyms: | GANODEROL A |
| MDL Number.: | MFCD17214919 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@H](CC/C=C(\C)/CO)[C@H]1CC[C@@]2([C@@]1(CC=C3C2=CC[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
| InChi: | InChI=1S/C30H46O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,21-22,25,31H,8,10,12-13,15-19H2,1-7H3/b20-9+/t21-,22-,25+,28-,29-,30+/m1/s1 |
| InChiKey: | InChIKey=QWFPQDGDUOGOJF-SPFFTVLFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.