* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | REHMAGLUTIN D |
CAS: | 103744-84-9 |
English Synonyms: | REHMAGLUTIN D |
MDL Number.: | MFCD17214923 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1CO[C@H]2[C@H]3[C@@H]1[C@@H]([C@H]([C@]3(CO2)O)Cl)O |
InChi: | InChI=1S/C9H13ClO4/c10-7-6(11)4-1-2-13-8-5(4)9(7,12)3-14-8/h4-8,11-12H,1-3H2/t4-,5-,6+,7-,8-,9-/m1/s1 |
InChiKey: | InChIKey=OFZRLVSQPBQNQB-FJYMVOSHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.