* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHLORIGIDOSIDE B |
CAS: | 288248-46-4 |
English Synonyms: | PHLORIGIDOSIDE B |
MDL Number.: | MFCD17214924 |
H bond acceptor: | 13 |
H bond donor: | 6 |
Smile: | CC(=O)O[C@]1(C[C@H]([C@]2([C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)C |
InChi: | InChI=1S/C19H28O13/c1-7(21)32-18(2)4-10(22)19(27)8(15(26)28-3)6-29-17(14(18)19)31-16-13(25)12(24)11(23)9(5-20)30-16/h6,9-14,16-17,20,22-25,27H,4-5H2,1-3H3/t9-,10-,11-,12+,13-,14-,16+,17+,18+,19-/m1/s1 |
InChiKey: | InChIKey=HTOSOQRDFDYOGW-OKJPHAGLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.