* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GELSEMIOL |
| CAS: | 110414-77-2 |
| English Synonyms: | GELSEMIOL |
| MDL Number.: | MFCD17214926 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@H]1C[C@H]2[C@@H]([C@@H]1CO)[C@@H](C(=O)O2)CO |
| InChi: | InChI=1S/C10H16O4/c1-5-2-8-9(6(5)3-11)7(4-12)10(13)14-8/h5-9,11-12H,2-4H2,1H3/t5-,6+,7-,8-,9-/m0/s1 |
| InChiKey: | InChIKey=FNYPTQQTJGQJNF-BGKGJTHRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.