* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CLEOMISCOSIN C |
| CAS: | 84575-10-0 |
| English Synonyms: | CLEOMISCOSIN C |
| MDL Number.: | MFCD17214939 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | COc1cc2ccc(=O)oc2c3c1O[C@@H]([C@H](O3)CO)c4cc(c(c(c4)OC)O)OC |
| InChi: | InChI=1S/C21H20O9/c1-25-12-7-11(8-13(26-2)17(12)24)18-15(9-22)28-21-19-10(4-5-16(23)29-19)6-14(27-3)20(21)30-18/h4-8,15,18,22,24H,9H2,1-3H3/t15-,18-/m1/s1 |
| InChiKey: | InChIKey=GZXPCBAETDEQAX-CRAIPNDOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.