* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,10-DIOXADISPIRO[2.2.4.2]DODECANE |
| CAS: | 52875-47-5 |
| English Synonyms: | 7,10-DIOXADISPIRO[2.2.4(6).2(3)]DODECANE ; 7,10-DIOXADISPIRO[2.2.4.2]DODECANE |
| MDL Number.: | MFCD17215151 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1CC12CCC3(CC2)OCCO3 |
| InChi: | InChI=1S/C10H16O2/c1-2-9(1)3-5-10(6-4-9)11-7-8-12-10/h1-8H2 |
| InChiKey: | InChIKey=UDXVMLIGVOVHGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.