* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-ASPARTATE CHROMIUM |
| English Synonyms: | L-ASPARTATE CHROMIUM |
| MDL Number.: | MFCD17215370 |
| H bond acceptor: | 15 |
| H bond donor: | 3 |
| Smile: | C1[C@@H](C(=O)O[Cr]2OC(=O)[C@H](CC(=O)O[Cr](OC1=O)OC(=O)C[C@@H](C(=O)O2)N)N)N |
| InChi: | InChI=1S/3C4H7NO4.2Cr/c3*5-2(4(8)9)1-3(6)7;;/h3*2H,1,5H2,(H,6,7)(H,8,9);;/q;;;2*+3/p-6/t3*2-;;/m000../s1 |
| InChiKey: | InChIKey=UQXRTVQTVRUTBA-IMQYDAPUSA-H |
* If the product has intellectual property rights, a license granted is must or contact us.