* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-BROMO-1,2,3,4-TETRAHYDROACRIDINE |
| CAS: | 337915-93-2 |
| English Synonyms: | 9-BROMO-1,2,3,4-TETRAHYDROACRIDINE ; ACRIDINE,9-BROMO-1,2,3,4-TETRAHYDRO- |
| MDL Number.: | MFCD17215373 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)c(c3c(n2)CCCC3)Br |
| InChi: | InChI=1S/C13H12BrN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2 |
| InChiKey: | InChIKey=ZJPQYDJYNNEYHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.