* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HEPTANAMIDE, 7-[(4'-CYANO[1,1'-BIPHENYL]-4-YL)OXY]-N-HYDROXY- |
CAS: | 191228-04-3 |
English Synonyms: | HEPTANAMIDE, 7-[(4'-CYANO[1,1'-BIPHENYL]-4-YL)OXY]-N-HYDROXY- |
MDL Number.: | MFCD17215384 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(ccc1C#N)c2ccc(cc2)OCCCCCCC(=O)NO |
InChi: | InChI=1S/C20H22N2O3/c21-15-16-6-8-17(9-7-16)18-10-12-19(13-11-18)25-14-4-2-1-3-5-20(23)22-24/h6-13,24H,1-5,14H2,(H,22,23) |
InChiKey: | InChIKey=DWIYBCKFYUQVLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.