* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHOXY-QUINAZOLIN-4-OL |
| English Synonyms: | 7-METHOXY-QUINAZOLIN-4-OL |
| MDL Number.: | MFCD17215788 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1ccc2c(c1)ncnc2O |
| InChi: | InChI=1S/C9H8N2O2/c1-13-6-2-3-7-8(4-6)10-5-11-9(7)12/h2-5H,1H3,(H,10,11,12) |
| InChiKey: | InChIKey=PPGWFCHOWMFNRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.