* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CB-DMB |
| English Synonyms: | CB-DMB |
| MDL Number.: | MFCD17215951 |
| H bond acceptor: | 8 |
| H bond donor: | 5 |
| Smile: | Cc1ccc(c(c1)C)CNC(=N)NC(=O)c2c(nc(c(n2)Cl)NCc3ccc(cc3)Cl)N |
| InChi: | InChI=1S/C22H23Cl2N7O/c1-12-3-6-15(13(2)9-12)11-28-22(26)31-21(32)17-19(25)30-20(18(24)29-17)27-10-14-4-7-16(23)8-5-14/h3-9H,10-11H2,1-2H3,(H3,25,27,30)(H3,26,28,31,32) |
| InChiKey: | InChIKey=MGLQFHOCPGELNL-UHFFFAOYSA-N |
|
|
|
|
| Symbol: |
GHS07
|
| Signal word: | Warning |
| Hazard statements: | H302-H319 |
| Precautionary statements: | P305 + P351 + P338 |
| hazard symbol: | Xn |
| Risk Code: | R:22-36 |
| Safe Code: | S:26 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.