* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,8-DIFLUORO-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
English Synonyms: | 6,8-DIFLUORO-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
MDL Number.: | MFCD17216148 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(c2c1OCCCC2N)F)F |
InChi: | InChI=1S/C10H11F2NO/c11-6-4-7(12)10-8(13)2-1-3-14-9(10)5-6/h4-5,8H,1-3,13H2 |
InChiKey: | InChIKey=KYHFXJSEFXVAFE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.