* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-PHENYL-1-OXASPIRO[2.5]OCTANE |
| English Synonyms: | 6-PHENYL-1-OXASPIRO[2.5]OCTANE |
| MDL Number.: | MFCD17218336 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)C2CCC3(CC2)CO3 |
| InChi: | InChI=1S/C13H16O/c1-2-4-11(5-3-1)12-6-8-13(9-7-12)10-14-13/h1-5,12H,6-10H2 |
| InChiKey: | InChIKey=RDIINJBTORBOFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.