* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1983120 |
| English Synonyms: | OTAVA-BB 1983120 |
| MDL Number.: | MFCD17224723 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1ccccc1C(Cc2csc(n2)C)N |
| InChi: | InChI=1S/C13H16N2S/c1-9-5-3-4-6-12(9)13(14)7-11-8-16-10(2)15-11/h3-6,8,13H,7,14H2,1-2H3 |
| InChiKey: | InChIKey=LJWHAFXFTSLVPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.