Molecular Structure:
CCD No.:CCD03486892
OTAVA-BB 1984414
Formula:C12 H13 F N2 S
MolWeight:236.313
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1984414 |
| English Synonyms： | OTAVA-BB 1984414 |
| MDL Number.： | MFCD17224728 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | Cc1nc(cs1)CC(c2ccccc2F)N |
| InChi： | InChI=1S/C12H13FN2S/c1-8-15-9(7-16-8)6-12(14)10-4-2-3-5-11(10)13/h2-5,7,12H,6,14H2,1H3 |
| InChiKey： | InChIKey=ZMEJATFIKWCDRA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
