* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PENTYL 2-(1,4-DIAZEPAN-1-YL)ACETATE |
| English Synonyms: | PENTYL 2-(1,4-DIAZEPAN-1-YL)ACETATE |
| MDL Number.: | MFCD17227542 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCCOC(=O)CN1CCCNCC1 |
| InChi: | InChI=1S/C12H24N2O2/c1-2-3-4-10-16-12(15)11-14-8-5-6-13-7-9-14/h13H,2-11H2,1H3 |
| InChiKey: | InChIKey=CGXWWORYXWSKSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.