* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOBUTYL 2-(1,4-DIAZEPAN-1-YL)ACETATE |
| English Synonyms: | CYCLOBUTYL 2-(1,4-DIAZEPAN-1-YL)ACETATE |
| MDL Number.: | MFCD17227543 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C1CC(C1)OC(=O)CN2CCCNCC2 |
| InChi: | InChI=1S/C11H20N2O2/c14-11(15-10-3-1-4-10)9-13-7-2-5-12-6-8-13/h10,12H,1-9H2 |
| InChiKey: | InChIKey=MQZGQYLDUKNKEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.