* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(PYRROLIDIN-2-YL)QUINOXALINE |
| English Synonyms: | 6-(PYRROLIDIN-2-YL)QUINOXALINE |
| MDL Number.: | MFCD17234202 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1C3CCCN3)nccn2 |
| InChi: | InChI=1S/C12H13N3/c1-2-10(13-5-1)9-3-4-11-12(8-9)15-7-6-14-11/h3-4,6-8,10,13H,1-2,5H2 |
| InChiKey: | InChIKey=DRJCHUPKFZCLIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.