* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-2-N,2-N-DIMETHYL-4-N-PENTYL-1,3,5-TRIAZINE-2,4-DIAMINE |
| English Synonyms: | 6-CHLORO-2-N,2-N-DIMETHYL-4-N-PENTYL-1,3,5-TRIAZINE-2,4-DIAMINE |
| MDL Number.: | MFCD17237423 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCCCNc1nc(nc(n1)Cl)N(C)C |
| InChi: | InChI=1S/C10H18ClN5/c1-4-5-6-7-12-9-13-8(11)14-10(15-9)16(2)3/h4-7H2,1-3H3,(H,12,13,14,15) |
| InChiKey: | InChIKey=UIQHOFVYSXJPPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.