Molecular Structure:
CCD No.:CCD03502109
OTAVA-BB 2039136
Formula:C9 H10 N2 O
MolWeight:162.191
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2039136 |
| English Synonyms： | OTAVA-BB 2039136 |
| MDL Number.： | MFCD17240427 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | c1cn(ccc1=O)CCCC#N |
| InChi： | InChI=1S/C9H10N2O/c10-5-1-2-6-11-7-3-9(12)4-8-11/h3-4,7-8H,1-2,6H2 |
| InChiKey： | InChIKey=SCTMIRVKKQEACM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
