* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPAN-2-YL 2-(3-CYANO-1H-1,2,4-TRIAZOL-1-YL)ACETATE |
| English Synonyms: | PROPAN-2-YL 2-(3-CYANO-1H-1,2,4-TRIAZOL-1-YL)ACETATE |
| MDL Number.: | MFCD17241727 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(C)OC(=O)Cn1cnc(n1)C#N |
| InChi: | InChI=1S/C8H10N4O2/c1-6(2)14-8(13)4-12-5-10-7(3-9)11-12/h5-6H,4H2,1-2H3 |
| InChiKey: | InChIKey=ZAUZNJKYRWTFJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.