* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIHYDROANTHRACEN-9-AMINE |
English Synonyms: | 9,10-DIHYDROANTHRACEN-9-AMINE |
MDL Number.: | MFCD17243646 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)Cc3ccccc3C2N |
InChi: | InChI=1S/C14H13N/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8,14H,9,15H2 |
InChiKey: | InChIKey=BYDPSHUZBXOTOM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.