* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BROMO-9,10-DIHYDROANTHRACENE |
English Synonyms: | 9-BROMO-9,10-DIHYDROANTHRACENE |
MDL Number.: | MFCD17243650 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)Cc3ccccc3C2Br |
InChi: | InChI=1S/C14H11Br/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
InChiKey: | InChIKey=NTDWTHZSSNFONM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.